Organophosphorus compounds
eMolecules 7650-89-7 | Tribenzylphosphine, 98% | Strem Chemicals | MFCD00014439 | 304.373 | C21H21P | 98.000 | C(P(Cc1ccccc1)Cc1ccccc1)c1ccccc1 | 1g | 321336596
Tribenzylphosphine, 98% | Strem Chemicals | 7650-89-7 | MFCD00014439 | 304.373 | C21H21P | 98.000 | C(P(Cc1ccccc1)Cc1ccccc1)c1ccccc1 | 1g | 321336596
Chemscene ChemScene | XPhos Pd G2 | 5G | CS-W009569 | 0.98 | 1310584-14-5| MFCD20264878 | 786.8
ChemScene | XPhos Pd G2 | 5G | CS-W009569 | 0.98 | 1310584-14-5| MFCD20264878 | 786.8
![eMolecules 25240-33-9 | 1H,1'H-4,4'-Bipyrazole | ChemScene | MFCD02973360 | 134.142 | C6H6N4 | 95.000 | c1n[nH]cc1-c1cn[nH]c1 | 100mg | 712787845](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502482828.JPG-250.jpg)
eMolecules 25240-33-9 | 1H,1'H-4,4'-Bipyrazole | ChemScene | MFCD02973360 | 134.142 | C6H6N4 | 95.000 | c1n[nH]cc1-c1cn[nH]c1 | 100mg | 712787845
1H,1'H-4,4'-Bipyrazole | ChemScene | 25240-33-9 | MFCD02973360 | 134.142 | C6H6N4 | 95.000 | c1n[nH]cc1-c1cn[nH]c1 | 100mg | 712787845
Chemscene ChemScene | SPhos Pd G1 | 5G | CS-0035145 | 0.98 | 1028206-58-7| MFCD15144765 | 672.57
ChemScene | SPhos Pd G1 | 5G | CS-0035145 | 0.98 | 1028206-58-7| MFCD15144765 | 672.57
eMolecules 877864-04-5 | THP-SS-alcohol | Broadpharm | MFCD28505568 | 238.360 | C9H18O3S2 | 0.000 | OCCSSCCOC1CCCCO1 | 1g | 279709613
THP-SS-alcohol | Broadpharm | 877864-04-5 | MFCD28505568 | 238.360 | C9H18O3S2 | 0.000 | OCCSSCCOC1CCCCO1 | 1g | 279709613
eMolecules 787618-22-8 | RUPHOS | AstaTech | MFCD06798294 | 466.646 | C30H43O2P | 95.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 487586565
RUPHOS | AstaTech | 787618-22-8 | MFCD06798294 | 466.646 | C30H43O2P | 95.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 5g | 487586565
eMolecules 14471-18-2 | Cyclopropyl-thiophen-2-ylmethyl-amine | MFCD03856576 | 1g
Ambeed | 2-(Trifluoromethyl)-[11-biphenyl]-4-carboxylic acid | 1g | 600836812 | A298667 | 198205-79-7 | MFCD03424605 | 266.219 | C14H9F3O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Strem, An Ascensus Company CAS 654057-97-3. 10g. Trihexyl(tetradecyl)phosphonium bromide min. 95% CYPHOS IL 102. MFCD04117697
CAS 654057-97-3. 10g. Trihexyl(tetradecyl)phosphonium bromide min. 95% CYPHOS IL 102. MFCD04117697. Molecular Weight 563.76. Molecular Formula [(C6H13)3(C14H29)P]Brae. Color/form pale yellow liq. Strem 15-6378. http//www.strem.com/catalog/v/15-6378/
![eMolecules 2096339-46-5 | [2-Chloro-5-(pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl]boronic acid | Combi-Blocks | MFCD20441811 | 347.480 | C13H10BClF3NO4 | 97.000 | OB(O)c1cc(OCc2cccnc2)c(OC(F)(F)F)cc1Cl | 1g | 117523456](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502193243.JPG-250.jpg)
eMolecules 2096339-46-5 | [2-Chloro-5-(pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl]boronic acid | Combi-Blocks | MFCD20441811 | 347.480 | C13H10BClF3NO4 | 97.000 | OB(O)c1cc(OCc2cccnc2)c(OC(F)(F)F)cc1Cl | 1g | 117523456
[2-Chloro-5-(pyridin-3-ylmethoxy)-4-(trifluoromethoxy)phenyl]boronic acid | Combi-Blocks | 2096339-46-5 | MFCD20441811 | 347.480 | C13H10BClF3NO4 | 97.000 | OB(O)c1cc(OCc2cccnc2)c(OC(F)(F)F)cc1Cl | 1g | 117523456
(F)F.CCCC[P+](CCCC)(CCCC)CCCC | 1g | 632174314](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502422319.PNG-250.jpg)
eMolecules 1813-60-1 | Tetrabutylphosphonium tetrafluoroborate | Ambeed | MFCD00270144 | 346.240 | C16H36BF4P | 98.000 | F[B-](F)(F)F.CCCC[P+](CCCC)(CCCC)CCCC | 1g | 632174314
Tetrabutylphosphonium tetrafluoroborate | Ambeed | 1813-60-1 | MFCD00270144 | 346.240 | C16H36BF4P | 98.000 | F[B-](F)(F)F.CCCC[P+](CCCC)(CCCC)CCCC | 1g | 632174314
Strem, An Ascensus Company CAS 654057-97-3. 250g. Trihexyl(tetradecyl)phosphonium bromide min. 95% CYPHOS IL 102. MFCD04117697
CAS 654057-97-3. 250g. Trihexyl(tetradecyl)phosphonium bromide min. 95% CYPHOS IL 102. MFCD04117697. Molecular Weight 563.76. Molecular Formula [(C6H13)3(C14H29)P]Brae. Color/form pale yellow liq. Strem 15-6378. http//www.strem.com/catalog/v/15-6378/
eMolecules 1823249-05-3 | BENZYL 2-(PYRROLIDIN-1-YLMETHYL)MORPHOLINE-4-CARBOXYLATE | MFCD20039689 | 1g
Ambeed | 7-Methoxyisobenzofuran-1(3H)-one | 100mg | 570576187 | A298634 | 28281-58-5 | MFCD15146118 | 164.160 | C9H8O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
FUJIFILM BIOSCIENCES INC TETRABUTYLPHOSPHONIUM TETRAPHE
*Orders for this supplier are non-cancellable/non-returnable once they are processed.* Tetrabutylphosphonium Tetraphenylborate 5GR
eMolecules 787618-22-8 | 2-Dicyclohexylphosphino-2,6-DI-I-Propoxy-1,1-Biphenyl | AA Blocks LLC | MFCD06798294 | 466.646 | C30H43O2P | 0.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 1g | 436000262
2-Dicyclohexylphosphino-2,6-DI-I-Propoxy-1,1-Biphenyl | AA Blocks LLC | 787618-22-8 | MFCD06798294 | 466.646 | C30H43O2P | 0.000 | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 | 1g | 436000262